Complex.java

Index Score
org.apache.commons.math.complex
Commons Math

View: Reasons, Metrics, Source Code

These are the metrics that contribute to the Enerjy Score for this file, ranked by impact. So the metrics listed at the top influence the score to a greater extent that the metrics listed at the bottom.

MetricDescription
DOC_COMMENTNumber of javadoc comment lines
COMMENTSComment lines
SIZESize of the file in bytes
DECL_COMMENTSComments in declarations
COMPARISONSNumber of comparison operators
LINESNumber of lines in the source file
RETURNSNumber of return points from functions
JAVA0078JAVA0078 Floating point values compared with ==
JAVA0034JAVA0034 Missing braces in if statement
CYCLOMATICCyclomatic complexity
BLOCKSNumber of blocks
JAVA0075JAVA0075 Method parameter hides field
INTERFACE_COMPLEXITYInterface complexity
JAVA0117JAVA0117 Missing javadoc: method 'method'
FUNCTIONSNumber of function declarations
PROGRAM_VOLUMEHalstead program volume
JAVA0136JAVA0136 N methods defined in class (maximum: M)
JAVA0126JAVA0126 Method declares unchecked exception in throws
EXEC_COMMENTSComments in executable code
LINE_COMMENTNumber of line comments
JAVA0110JAVA0110 Incorrect javadoc: no @return tag
LOOPSNumber of loops
OPERATORSNumber of operators
JAVA0108JAVA0108 Incorrect javadoc: no @param tag for 'parameter'
UNIQUE_OPERATORSNumber of unique operators
PROGRAM_LENGTHHalstead program length
PARAMSNumber of formal parameter declarations
JAVA0145JAVA0145 Tab character used in source file
/* * Licensed to the Apache Software Foundation (ASF) under one or more * contributor license agreements. See the NOTICE file distributed with * this work for additional information regarding copyright ownership. * The ASF licenses this file to You under the Apache License, Version 2.0 * (the "License"); you may not use this file except in compliance with * the License. You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package org.apache.commons.math.complex; import java.io.Serializable; import org.apache.commons.math.util.MathUtils; /** * Representation of a Complex number - a number which has both a * real and imaginary part. * <p> * Implementations of arithmetic operations handle <code>NaN</code> and * infinite values according to the rules for {@link java.lang.Double} * arithmetic, applying definitional formulas and returning <code>NaN</code> or * infinite values in real or imaginary parts as these arise in computation. * See individual method javadocs for details.</p> * <p> * {@link #equals} identifies all values with <code>NaN</code> in either real * or imaginary part - e.g., <pre> * <code>1 + NaNi == NaN + i == NaN + NaNi.</code></pre></p> * * @version $Revision: 620373 $ $Date: 2008-02-10 20:18:39 -0500 (Sun, 10 Feb 2008) $ */ public class Complex implements Serializable { /** Serializable version identifier */ private static final long serialVersionUID = -6530173849413811929L; /** The square root of -1. A number representing "0.0 + 1.0i" */ public static final Complex I = new Complex(0.0, 1.0); /** A complex number representing "NaN + NaNi" */ public static final Complex NaN = new Complex(Double.NaN, Double.NaN); /** A complex number representing "+INF + INFi" */ public static final Complex INF = new Complex(Double.POSITIVE_INFINITY, Double.POSITIVE_INFINITY); /** A complex number representing "1.0 + 0.0i" */ public static final Complex ONE = new Complex(1.0, 0.0); /** A complex number representing "0.0 + 0.0i" */ public static final Complex ZERO = new Complex(0.0, 0.0); /** * The imaginary part * @deprecated to be made final and private in 2.0 */ protected double imaginary; /** * The real part * @deprecated to be made final and private in 2.0 */ protected double real; /** * Create a complex number given the real and imaginary parts. * * @param real the real part * @param imaginary the imaginary part */ public Complex(double real, double imaginary) { super(); this.real = real; this.imaginary = imaginary; } /** * Return the absolute value of this complex number. * <p> * Returns <code>NaN</code> if either real or imaginary part is * <code>NaN</code> and <code>Double.POSITIVE_INFINITY</code> if * neither part is <code>NaN</code>, but at least one part takes an infinite * value.</p> * * @return the absolute value */ public double abs() { if (isNaN()) { return Double.NaN; } if (isInfinite()) { return Double.POSITIVE_INFINITY; } if (Math.abs(real) < Math.abs(imaginary)) { if (imaginary == 0.0) { return Math.abs(real); } double q = real / imaginary; return (Math.abs(imaginary) * Math.sqrt(1 + q*q)); } else { if (real == 0.0) { return Math.abs(imaginary); } double q = imaginary / real; return (Math.abs(real) * Math.sqrt(1 + q*q)); } } /** * Return the sum of this complex number and the given complex number. * <p> * Uses the definitional formula * <pre> * (a + bi) + (c + di) = (a+c) + (b+d)i * </pre></p> * <p> * If either this or <code>rhs</code> has a NaN value in either part, * {@link #NaN} is returned; otherwise Inifinite and NaN values are * returned in the parts of the result according to the rules for * {@link java.lang.Double} arithmetic.</p> * * @param rhs the other complex number * @return the complex number sum * @throws NullPointerException if <code>rhs</code> is null */ public Complex add(Complex rhs) { return createComplex(real + rhs.getReal(), imaginary + rhs.getImaginary()); } /** * Return the conjugate of this complex number. The conjugate of * "A + Bi" is "A - Bi". * <p> * {@link #NaN} is returned if either the real or imaginary * part of this Complex number equals <code>Double.NaN</code>.</p> * <p> * If the imaginary part is infinite, and the real part is not NaN, * the returned value has infinite imaginary part of the opposite * sign - e.g. the conjugate of <code>1 + POSITIVE_INFINITY i</code> * is <code>1 - NEGATIVE_INFINITY i</code></p> * * @return the conjugate of this Complex object */ public Complex conjugate() { if (isNaN()) { return NaN; } return createComplex(real, -imaginary); } /** * Return the quotient of this complex number and the given complex number. * <p> * Implements the definitional formula * <pre><code> * a + bi ac + bd + (bc - ad)i * ----------- = ------------------------- * c + di c<sup>2</sup> + d<sup>2</sup> * </code></pre> * but uses * <a href="http://doi.acm.org/10.1145/1039813.1039814"> * prescaling of operands</a> to limit the effects of overflows and * underflows in the computation.</p> * <p> * Infinite and NaN values are handled / returned according to the * following rules, applied in the order presented: * <ul> * <li>If either this or <code>rhs</code> has a NaN value in either part, * {@link #NaN} is returned.</li> * <li>If <code>rhs</code> equals {@link #ZERO}, {@link #NaN} is returned. * </li> * <li>If this and <code>rhs</code> are both infinite, * {@link #NaN} is returned.</li> * <li>If this is finite (i.e., has no infinite or NaN parts) and * <code>rhs</code> is infinite (one or both parts infinite), * {@link #ZERO} is returned.</li> * <li>If this is infinite and <code>rhs</code> is finite, NaN values are * returned in the parts of the result if the {@link java.lang.Double} * rules applied to the definitional formula force NaN results.</li> * </ul></p> * * @param rhs the other complex number * @return the complex number quotient * @throws NullPointerException if <code>rhs</code> is null */ public Complex divide(Complex rhs) { if (isNaN() || rhs.isNaN()) { return NaN; } double c = rhs.getReal(); double d = rhs.getImaginary(); if (c == 0.0 && d == 0.0) { return NaN; } if (rhs.isInfinite() && !isInfinite()) { return ZERO; } if (Math.abs(c) < Math.abs(d)) { if (d == 0.0) { return createComplex(real/c, imaginary/c); } double q = c / d; double denominator = c * q + d; return createComplex((real * q + imaginary) / denominator, (imaginary * q - real) / denominator); } else { if (c == 0.0) { return createComplex(imaginary/d, -real/c); } double q = d / c; double denominator = d * q + c; return createComplex((imaginary * q + real) / denominator, (imaginary - real * q) / denominator); } } /** * Test for the equality of two Complex objects. * <p> * If both the real and imaginary parts of two Complex numbers * are exactly the same, and neither is <code>Double.NaN</code>, the two * Complex objects are considered to be equal.</p> * <p> * All <code>NaN</code> values are considered to be equal - i.e, if either * (or both) real and imaginary parts of the complex number are equal * to <code>Double.NaN</code>, the complex number is equal to * <code>Complex.NaN</code>.</p> * * @param other Object to test for equality to this * @return true if two Complex objects are equal, false if * object is null, not an instance of Complex, or * not equal to this Complex instance * */ public boolean equals(Object other) { boolean ret; if (this == other) { ret = true; } else if (other == null) { ret = false; } else { try { Complex rhs = (Complex)other; if (rhs.isNaN()) { ret = this.isNaN(); } else { ret = (Double.doubleToRawLongBits(real) == Double.doubleToRawLongBits(rhs.getReal())) && (Double.doubleToRawLongBits(imaginary) == Double.doubleToRawLongBits(rhs.getImaginary())); } } catch (ClassCastException ex) { // ignore exception ret = false; } } return ret; } /** * Get a hashCode for the complex number. * <p> * All NaN values have the same hash code.</p> * * @return a hash code value for this object */ public int hashCode() { if (isNaN()) { return 7; } return 37 * (17 * MathUtils.hash(imaginary) + MathUtils.hash(real)); } /** * Access the imaginary part. * * @return the imaginary part */ public double getImaginary() { return imaginary; } /** * Access the real part. * * @return the real part */ public double getReal() { return real; } /** * Returns true if either or both parts of this complex number is NaN; * false otherwise * * @return true if either or both parts of this complex number is NaN; * false otherwise */ public boolean isNaN() { return Double.isNaN(real) || Double.isNaN(imaginary); } /** * Returns true if either the real or imaginary part of this complex number * takes an infinite value (either <code>Double.POSITIVE_INFINITY</code> or * <code>Double.NEGATIVE_INFINITY</code>) and neither part * is <code>NaN</code>. * * @return true if one or both parts of this complex number are infinite * and neither part is <code>NaN</code> */ public boolean isInfinite() { return !isNaN() && (Double.isInfinite(real) || Double.isInfinite(imaginary)); } /** * Return the product of this complex number and the given complex number. * <p> * Implements preliminary checks for NaN and infinity followed by * the definitional formula: * <pre><code> * (a + bi)(c + di) = (ac - bd) + (ad + bc)i * </code></pre> * </p> * <p> * Returns {@link #NaN} if either this or <code>rhs</code> has one or more * NaN parts. * </p> * Returns {@link #INF} if neither this nor <code>rhs</code> has one or more * NaN parts and if either this or <code>rhs</code> has one or more * infinite parts (same result is returned regardless of the sign of the * components). * </p> * <p> * Returns finite values in components of the result per the * definitional formula in all remaining cases. * </p> * * @param rhs the other complex number * @return the complex number product * @throws NullPointerException if <code>rhs</code> is null */ public Complex multiply(Complex rhs) { if (isNaN() || rhs.isNaN()) { return NaN; } if (Double.isInfinite(real) || Double.isInfinite(imaginary) || Double.isInfinite(rhs.real)|| Double.isInfinite(rhs.imaginary)) { // we don't use Complex.isInfinite() to avoid testing for NaN again return INF; } return createComplex(real * rhs.real - imaginary * rhs.imaginary, real * rhs.imaginary + imaginary * rhs.real); } /** * Return the additive inverse of this complex number. * <p> * Returns <code>Complex.NaN</code> if either real or imaginary * part of this Complex number equals <code>Double.NaN</code>.</p> * * @return the negation of this complex number */ public Complex negate() { if (isNaN()) { return NaN; } return createComplex(-real, -imaginary); } /** * Return the difference between this complex number and the given complex * number. * <p> * Uses the definitional formula * <pre> * (a + bi) - (c + di) = (a-c) + (b-d)i * </pre></p> * <p> * If either this or <code>rhs</code> has a NaN value in either part, * {@link #NaN} is returned; otherwise inifinite and NaN values are * returned in the parts of the result according to the rules for * {@link java.lang.Double} arithmetic. </p> * * @param rhs the other complex number * @return the complex number difference * @throws NullPointerException if <code>rhs</code> is null */ public Complex subtract(Complex rhs) { if (isNaN() || rhs.isNaN()) { return NaN; } return createComplex(real - rhs.getReal(), imaginary - rhs.getImaginary()); } /** * Compute the * <a href="http://mathworld.wolfram.com/InverseCosine.html" TARGET="_top"> * inverse cosine</a> of this complex number. * <p> * Implements the formula: <pre> * <code> acos(z) = -i (log(z + i (sqrt(1 - z<sup>2</sup>))))</code></pre></p> * <p> * Returns {@link Complex#NaN} if either real or imaginary part of the * input argument is <code>NaN</code> or infinite.</p> * * @return the inverse cosine of this complex number * @since 1.2 */ public Complex acos() { if (isNaN()) { return Complex.NaN; } return this.add(this.sqrt1z().multiply(Complex.I)).log() .multiply(Complex.I.negate()); } /** * Compute the * <a href="http://mathworld.wolfram.com/InverseSine.html" TARGET="_top"> * inverse sine</a> of this complex number. * <p> * Implements the formula: <pre> * <code> asin(z) = -i (log(sqrt(1 - z<sup>2</sup>) + iz)) </code></pre></p> * <p> * Returns {@link Complex#NaN} if either real or imaginary part of the * input argument is <code>NaN</code> or infinite.</p> * * @return the inverse sine of this complex number. * @since 1.2 */ public Complex asin() { if (isNaN()) { return Complex.NaN; } return sqrt1z().add(this.multiply(Complex.I)).log() .multiply(Complex.I.negate()); } /** * Compute the * <a href="http://mathworld.wolfram.com/InverseTangent.html" TARGET="_top"> * inverse tangent</a> of this complex number. * <p> * Implements the formula: <pre> * <code> atan(z) = (i/2) log((i + z)/(i - z)) </code></pre></p> * <p> * Returns {@link Complex#NaN} if either real or imaginary part of the * input argument is <code>NaN</code> or infinite.</p> * * @return the inverse tangent of this complex number * @since 1.2 */ public Complex atan() { if (isNaN()) { return Complex.NaN; } return this.add(Complex.I).divide(Complex.I.subtract(this)).log() .multiply(Complex.I.divide(createComplex(2.0, 0.0))); } /** * Compute the * <a href="http://mathworld.wolfram.com/Cosine.html" TARGET="_top"> * cosine</a> * of this complex number. * <p> * Implements the formula: <pre> * <code> cos(a + bi) = cos(a)cosh(b) - sin(a)sinh(b)i</code></pre> * where the (real) functions on the right-hand side are * {@link java.lang.Math#sin}, {@link java.lang.Math#cos}, * {@link MathUtils#cosh} and {@link MathUtils#sinh}.</p> * <p> * Returns {@link Complex#NaN} if either real or imaginary part of the * input argument is <code>NaN</code>.</p> * <p> * Infinite values in real or imaginary parts of the input may result in * infinite or NaN values returned in parts of the result.<pre> * Examples: * <code> * cos(1 &plusmn; INFINITY i) = 1 &#x2213; INFINITY i * cos(&plusmn;INFINITY + i) = NaN + NaN i * cos(&plusmn;INFINITY &plusmn; INFINITY i) = NaN + NaN i</code></pre></p> * * @return the cosine of this complex number * @since 1.2 */ public Complex cos() { if (isNaN()) { return Complex.NaN; } return createComplex(Math.cos(real) * MathUtils.cosh(imaginary), -Math.sin(real) * MathUtils.sinh(imaginary)); } /** * Compute the * <a href="http://mathworld.wolfram.com/HyperbolicCosine.html" TARGET="_top"> * hyperbolic cosine</a> of this complex number. * <p> * Implements the formula: <pre> * <code> cosh(a + bi) = cosh(a)cos(b) + sinh(a)sin(b)i</code></pre> * where the (real) functions on the right-hand side are * {@link java.lang.Math#sin}, {@link java.lang.Math#cos}, * {@link MathUtils#cosh} and {@link MathUtils#sinh}.</p> * <p> * Returns {@link Complex#NaN} if either real or imaginary part of the * input argument is <code>NaN</code>.</p> * <p> * Infinite values in real or imaginary parts of the input may result in * infinite or NaN values returned in parts of the result.<pre> * Examples: * <code> * cosh(1 &plusmn; INFINITY i) = NaN + NaN i * cosh(&plusmn;INFINITY + i) = INFINITY &plusmn; INFINITY i * cosh(&plusmn;INFINITY &plusmn; INFINITY i) = NaN + NaN i</code></pre></p> * * @return the hyperbolic cosine of this complex number. * @since 1.2 */ public Complex cosh() { if (isNaN()) { return Complex.NaN; } return createComplex(MathUtils.cosh(real) * Math.cos(imaginary), MathUtils.sinh(real) * Math.sin(imaginary)); } /** * Compute the * <a href="http://mathworld.wolfram.com/ExponentialFunction.html" TARGET="_top"> * exponential function</a> of this complex number. * <p> * Implements the formula: <pre> * <code> exp(a + bi) = exp(a)cos(b) + exp(a)sin(b)i</code></pre> * where the (real) functions on the right-hand side are * {@link java.lang.Math#exp}, {@link java.lang.Math#cos}, and * {@link java.lang.Math#sin}.</p> * <p> * Returns {@link Complex#NaN} if either real or imaginary part of the * input argument is <code>NaN</code>.</p> * <p> * Infinite values in real or imaginary parts of the input may result in * infinite or NaN values returned in parts of the result.<pre> * Examples: * <code> * exp(1 &plusmn; INFINITY i) = NaN + NaN i * exp(INFINITY + i) = INFINITY + INFINITY i * exp(-INFINITY + i) = 0 + 0i * exp(&plusmn;INFINITY &plusmn; INFINITY i) = NaN + NaN i</code></pre></p> * * @return <i>e</i><sup><code>this</code></sup> * @since 1.2 */ public Complex exp() { if (isNaN()) { return Complex.NaN; } double expReal = Math.exp(real); return createComplex(expReal * Math.cos(imaginary), expReal * Math.sin(imaginary)); } /** * Compute the * <a href="http://mathworld.wolfram.com/NaturalLogarithm.html" TARGET="_top"> * natural logarithm</a> of this complex number. * <p> * Implements the formula: <pre> * <code> log(a + bi) = ln(|a + bi|) + arg(a + bi)i</code></pre> * where ln on the right hand side is {@link java.lang.Math#log}, * <code>|a + bi|</code> is the modulus, {@link Complex#abs}, and * <code>arg(a + bi) = {@link java.lang.Math#atan2}(b, a)</code></p> * <p> * Returns {@link Complex#NaN} if either real or imaginary part of the * input argument is <code>NaN</code>.</p> * <p> * Infinite (or critical) values in real or imaginary parts of the input may * result in infinite or NaN values returned in parts of the result.<pre> * Examples: * <code> * log(1 &plusmn; INFINITY i) = INFINITY &plusmn; (&pi;/2)i * log(INFINITY + i) = INFINITY + 0i * log(-INFINITY + i) = INFINITY + &pi;i * log(INFINITY &plusmn; INFINITY i) = INFINITY &plusmn; (&pi;/4)i * log(-INFINITY &plusmn; INFINITY i) = INFINITY &plusmn; (3&pi;/4)i * log(0 + 0i) = -INFINITY + 0i * </code></pre></p> * * @return ln of this complex number. * @since 1.2 */ public Complex log() { if (isNaN()) { return Complex.NaN; } return createComplex(Math.log(abs()), Math.atan2(imaginary, real)); } /** * Returns of value of this complex number raised to the power of <code>x</code>. * <p> * Implements the formula: <pre> * <code> y<sup>x</sup> = exp(x&middot;log(y))</code></pre> * where <code>exp</code> and <code>log</code> are {@link #exp} and * {@link #log}, respectively.</p> * <p> * Returns {@link Complex#NaN} if either real or imaginary part of the * input argument is <code>NaN</code> or infinite, or if <code>y</code> * equals {@link Complex#ZERO}.</p> * * @param x the exponent. * @return <code>this</code><sup><code>x</code></sup> * @throws NullPointerException if x is null * @since 1.2 */ public Complex pow(Complex x) { if (x == null) { throw new NullPointerException(); } return this.log().multiply(x).exp(); } /** * Compute the * <a href="http://mathworld.wolfram.com/Sine.html" TARGET="_top"> * sine</a> * of this complex number. * <p> * Implements the formula: <pre> * <code> sin(a + bi) = sin(a)cosh(b) - cos(a)sinh(b)i</code></pre> * where the (real) functions on the right-hand side are * {@link java.lang.Math#sin}, {@link java.lang.Math#cos}, * {@link MathUtils#cosh} and {@link MathUtils#sinh}.</p> * <p> * Returns {@link Complex#NaN} if either real or imaginary part of the * input argument is <code>NaN</code>.</p> * <p> * Infinite values in real or imaginary parts of the input may result in * infinite or NaN values returned in parts of the result.<pre> * Examples: * <code> * sin(1 &plusmn; INFINITY i) = 1 &plusmn; INFINITY i * sin(&plusmn;INFINITY + i) = NaN + NaN i * sin(&plusmn;INFINITY &plusmn; INFINITY i) = NaN + NaN i</code></pre></p> * * @return the sine of this complex number. * @since 1.2 */ public Complex sin() { if (isNaN()) { return Complex.NaN; } return createComplex(Math.sin(real) * MathUtils.cosh(imaginary), Math.cos(real) * MathUtils.sinh(imaginary)); } /** * Compute the * <a href="http://mathworld.wolfram.com/HyperbolicSine.html" TARGET="_top"> * hyperbolic sine</a> of this complex number. * <p> * Implements the formula: <pre> * <code> sinh(a + bi) = sinh(a)cos(b)) + cosh(a)sin(b)i</code></pre> * where the (real) functions on the right-hand side are * {@link java.lang.Math#sin}, {@link java.lang.Math#cos}, * {@link MathUtils#cosh} and {@link MathUtils#sinh}.</p> * <p> * Returns {@link Complex#NaN} if either real or imaginary part of the * input argument is <code>NaN</code>.</p> * <p> * Infinite values in real or imaginary parts of the input may result in * infinite or NaN values returned in parts of the result.<pre> * Examples: * <code> * sinh(1 &plusmn; INFINITY i) = NaN + NaN i * sinh(&plusmn;INFINITY + i) = &plusmn; INFINITY + INFINITY i * sinh(&plusmn;INFINITY &plusmn; INFINITY i) = NaN + NaN i</code></pre></p> * * @return the hyperbolic sine of this complex number * @since 1.2 */ public Complex sinh() { if (isNaN()) { return Complex.NaN; } return createComplex(MathUtils.sinh(real) * Math.cos(imaginary), MathUtils.cosh(real) * Math.sin(imaginary)); } /** * Compute the * <a href="http://mathworld.wolfram.com/SquareRoot.html" TARGET="_top"> * square root</a> of this complex number. * <p> * Implements the following algorithm to compute <code>sqrt(a + bi)</code>: * <ol><li>Let <code>t = sqrt((|a| + |a + bi|) / 2)</code></li> * <li><pre>if <code> a &#8805; 0</code> return <code>t + (b/2t)i</code> * else return <code>|b|/2t + sign(b)t i </code></pre></li> * </ol> * where <ul> * <li><code>|a| = {@link Math#abs}(a)</code></li> * <li><code>|a + bi| = {@link Complex#abs}(a + bi) </code></li> * <li><code>sign(b) = {@link MathUtils#indicator}(b) </code> * </ul></p> * <p> * Returns {@link Complex#NaN} if either real or imaginary part of the * input argument is <code>NaN</code>.</p> * <p> * Infinite values in real or imaginary parts of the input may result in * infinite or NaN values returned in parts of the result.<pre> * Examples: * <code> * sqrt(1 &plusmn; INFINITY i) = INFINITY + NaN i * sqrt(INFINITY + i) = INFINITY + 0i * sqrt(-INFINITY + i) = 0 + INFINITY i * sqrt(INFINITY &plusmn; INFINITY i) = INFINITY + NaN i * sqrt(-INFINITY &plusmn; INFINITY i) = NaN &plusmn; INFINITY i * </code></pre></p> * * @return the square root of this complex number * @since 1.2 */ public Complex sqrt() { if (isNaN()) { return Complex.NaN; } if (real == 0.0 && imaginary == 0.0) { return createComplex(0.0, 0.0); } double t = Math.sqrt((Math.abs(real) + abs()) / 2.0); if (real >= 0.0) { return createComplex(t, imaginary / (2.0 * t)); } else { return createComplex(Math.abs(imaginary) / (2.0 * t), MathUtils.indicator(imaginary) * t); } } /** * Compute the * <a href="http://mathworld.wolfram.com/SquareRoot.html" TARGET="_top"> * square root</a> of 1 - <code>this</code><sup>2</sup> for this complex * number. * <p> * Computes the result directly as * <code>sqrt(Complex.ONE.subtract(z.multiply(z)))</code>.</p> * <p> * Returns {@link Complex#NaN} if either real or imaginary part of the * input argument is <code>NaN</code>.</p> * <p> * Infinite values in real or imaginary parts of the input may result in * infinite or NaN values returned in parts of the result.</p> * * @return the square root of 1 - <code>this</code><sup>2</sup> * @since 1.2 */ public Complex sqrt1z() { return createComplex(1.0, 0.0).subtract(this.multiply(this)).sqrt(); } /** * Compute the * <a href="http://mathworld.wolfram.com/Tangent.html" TARGET="_top"> * tangent</a> of this complex number. * <p> * Implements the formula: <pre> * <code>tan(a + bi) = sin(2a)/(cos(2a)+cosh(2b)) + [sinh(2b)/(cos(2a)+cosh(2b))]i</code></pre> * where the (real) functions on the right-hand side are * {@link java.lang.Math#sin}, {@link java.lang.Math#cos}, * {@link MathUtils#cosh} and {@link MathUtils#sinh}.</p> * <p> * Returns {@link Complex#NaN} if either real or imaginary part of the * input argument is <code>NaN</code>.</p> * <p> * Infinite (or critical) values in real or imaginary parts of the input may * result in infinite or NaN values returned in parts of the result.<pre> * Examples: * <code> * tan(1 &plusmn; INFINITY i) = 0 + NaN i * tan(&plusmn;INFINITY + i) = NaN + NaN i * tan(&plusmn;INFINITY &plusmn; INFINITY i) = NaN + NaN i * tan(&plusmn;&pi;/2 + 0 i) = &plusmn;INFINITY + NaN i</code></pre></p> * * @return the tangent of this complex number * @since 1.2 */ public Complex tan() { if (isNaN()) { return Complex.NaN; } double real2 = 2.0 * real; double imaginary2 = 2.0 * imaginary; double d = Math.cos(real2) + MathUtils.cosh(imaginary2); return createComplex(Math.sin(real2) / d, MathUtils.sinh(imaginary2) / d); } /** * Compute the * <a href="http://mathworld.wolfram.com/HyperbolicTangent.html" TARGET="_top"> * hyperbolic tangent</a> of this complex number. * <p> * Implements the formula: <pre> * <code>tan(a + bi) = sinh(2a)/(cosh(2a)+cos(2b)) + [sin(2b)/(cosh(2a)+cos(2b))]i</code></pre> * where the (real) functions on the right-hand side are * {@link java.lang.Math#sin}, {@link java.lang.Math#cos}, * {@link MathUtils#cosh} and {@link MathUtils#sinh}.</p> * <p> * Returns {@link Complex#NaN} if either real or imaginary part of the * input argument is <code>NaN</code>.</p> * <p> * Infinite values in real or imaginary parts of the input may result in * infinite or NaN values returned in parts of the result.<pre> * Examples: * <code> * tanh(1 &plusmn; INFINITY i) = NaN + NaN i * tanh(&plusmn;INFINITY + i) = NaN + 0 i * tanh(&plusmn;INFINITY &plusmn; INFINITY i) = NaN + NaN i * tanh(0 + (&pi;/2)i) = NaN + INFINITY i</code></pre></p> * * @return the hyperbolic tangent of this complex number * @since 1.2 */ public Complex tanh() { if (isNaN()) { return Complex.NaN; } double real2 = 2.0 * real; double imaginary2 = 2.0 * imaginary; double d = MathUtils.cosh(real2) + Math.cos(imaginary2); return createComplex(MathUtils.sinh(real2) / d, Math.sin(imaginary2) / d); } /** * Create a complex number given the real and imaginary parts. * * @param real the real part * @param imaginary the imaginary part * @return a new complex number instance * @since 1.2 */ protected Complex createComplex(double real, double imaginary) { return new Complex(real, imaginary); } }

The table below shows all metrics for Complex.java.

MetricValueDescription
BLOCKS71.00Number of blocks
BLOCK_COMMENT16.00Number of block comment lines
COMMENTS561.00Comment lines
COMMENT_DENSITY 2.97Comment density
COMPARISONS90.00Number of comparison operators
CYCLOMATIC76.00Cyclomatic complexity
DECL_COMMENTS39.00Comments in declarations
DOC_COMMENT543.00Number of javadoc comment lines
ELOC189.00Effective lines of code
EXEC_COMMENTS 2.00Comments in executable code
EXITS29.00Procedure exits
FUNCTIONS29.00Number of function declarations
HALSTEAD_DIFFICULTY118.86Halstead difficulty
HALSTEAD_EFFORT 0.00Halstead effort
INTERFACE_COMPLEXITY71.00Interface complexity
JAVA0001 0.00JAVA0001 Package name does not contain only lower case letters
JAVA0002 0.00JAVA0002 Package name does not begin with a top level domain name or country code
JAVA0003 0.00JAVA0003 Minimize use of on-demand (.*) imports
JAVA0004 0.00JAVA0004 Unnecessary import from java.lang
JAVA0005 0.00JAVA0005 Imports not in specified order
JAVA0006 0.00JAVA0006 Empty finally block
JAVA0007 0.00JAVA0007 Should not declare public field
JAVA0008 0.00JAVA0008 Empty catch block
JAVA0009 0.00JAVA0009 Protected member in final class
JAVA0010 0.00JAVA0010 Non-instantiable class does not contain a non-private static member
JAVA0011 0.00JAVA0011 Abstract class does not contain an abstract method
JAVA0012 0.00JAVA0012 Non-constructor method with same name as declaring class
JAVA0013 0.00JAVA0013 Non-blank final field is not static
JAVA0014 0.00JAVA0014 Class with only static members has non-private constructor
JAVA0015 0.00JAVA0015 Package class contains public nested type
JAVA0016 0.00JAVA0016 Abstract class contains public constructor
JAVA0017 0.00JAVA0017 Class name does not have required form
JAVA0018 0.00JAVA0018 Method name does not have required form
JAVA0019 0.00JAVA0019 Interface name does not have required form
JAVA0020 0.00JAVA0020 Field name does not have required form
JAVA0021 0.00JAVA0021 Interface method name does not have required form
JAVA0022 0.00JAVA0022 Static final field name does not have required form
JAVA0023 0.00JAVA0023 Empty finalize method
JAVA0024 0.00JAVA0024 Empty class
JAVA0025 0.00JAVA0025 Method override is empty
JAVA0026 0.00JAVA0026 Finalize method with parameters
JAVA0029 0.00JAVA0029 Private method not used
JAVA0030 0.00JAVA0030 Private field not used
JAVA0031 0.00JAVA0031 Case statement not properly closed
JAVA0032 0.00JAVA0032 Switch statement missing default
JAVA0033 0.00JAVA0033 default: not last case in switch statement
JAVA0034 0.00JAVA0034 Missing braces in if statement
JAVA0035 0.00JAVA0035 Missing braces in for statement
JAVA0036 0.00JAVA0036 Missing braces in while statement
JAVA0038 0.00JAVA0038 Non-case label in switch statement
JAVA0039 0.00JAVA0039 Break statement with label
JAVA0040 0.00JAVA0040 Switch statement contains N cases (maximum: M)
JAVA0041 0.00JAVA0041 Nested synchronized block
JAVA0042 0.00JAVA0042 Empty synchronized statement
JAVA0043 0.00JAVA0043 Inner class does not use outer class
JAVA0044 0.00JAVA0044 Serializable class with no instance variables
JAVA0045 0.00JAVA0045 Serializable class with only transient fields
JAVA0046 0.00JAVA0046 Name of class not derived from Exception ends with 'Exception'
JAVA0047 0.00JAVA0047 Serializable class derives from invalid base class
JAVA0048 0.00JAVA0048 Name of class derived from Exception does not end with 'Exception'
JAVA0049 0.00JAVA0049 Nested block at depth N (maximum: M)
JAVA0050 0.00JAVA0050 Class derives from java.lang.Error
JAVA0051 0.00JAVA0051 Class derives from java.lang.RuntimeException
JAVA0052 0.00JAVA0052 Class derives from java.lang.Throwable
JAVA0053 0.00JAVA0053 Unused label
JAVA0054 0.00JAVA0054 Inheritance depth N exceeds maximum M
JAVA0055 0.00JAVA0055 Class should be interface
JAVA0056 0.00JAVA0056 Unnecessary abstract modifier for interface or annotation
JAVA0057 0.00JAVA0057 Unnecessary default constructor
JAVA0058 1.00JAVA0058 Constructor calls super()
JAVA0059 0.00JAVA0059 Method override only calls super()
JAVA0061 0.00JAVA0061 Inaccessible member in anonymous class
JAVA0062 0.00JAVA0062 Public class missing public member or protected constructor
JAVA0063 0.00JAVA0063 Identifier name should not contain '$'
JAVA0064 0.00JAVA0064 N variations of identifier name (maximum: M)
JAVA0065 0.00JAVA0065 Unnecessary final modifier for method in final class
JAVA0066 0.00JAVA0066 Unnecessary modifier for interface nested type
JAVA0067 0.00JAVA0067 Array descriptor on identifier name
JAVA0068 0.00JAVA0068 Modifiers not declared in recommended order
JAVA0071 0.00JAVA0071 Strings compared with ==
JAVA0073 0.00JAVA0073 Integer division in floating-point context
JAVA0074 0.00JAVA0074 Use of Object.notify()
JAVA0075 2.00JAVA0075 Method parameter hides field
JAVA0076 0.00JAVA0076 Use of magic number
JAVA0077 0.00JAVA0077 Private field not used in declaring class
JAVA0078 8.00JAVA0078 Floating point values compared with ==
JAVA0079 0.00JAVA0079 Use of instance to reference static member
JAVA0080 0.00JAVA0080 Import declaration not used
JAVA0081 0.00JAVA0081 Boolean literal in comparison
JAVA0082 0.00JAVA0082 Unnecessary widening cast
JAVA0083 0.00JAVA0083 Unnecessary instanceof test
JAVA0084 0.00JAVA0084 Should use compound assignment operator
JAVA0085 0.00JAVA0085 Use of sun.* class
JAVA0087 0.00JAVA0087 Use of Thread.sleep()
JAVA0089 0.00JAVA0089 Use of restricted package
JAVA0092 0.00JAVA0092 Use of restricted type
JAVA0093 0.00JAVA0093 Redundant assignment
JAVA0094 0.00JAVA0094 Field hides a superclass field
JAVA0095 0.00JAVA0095 Uninitialized private field
JAVA0096 0.00JAVA0096 Field in nested class hides outer field
JAVA0098 1.00JAVA0098 Minimize use of implicit field initializers
JAVA0100 0.00JAVA0100 Class contains N non-final fields (maximum: M)
JAVA0101 0.00JAVA0101 Unnecessary modifier for field in interface
JAVA0102 0.00JAVA0102 Last statement in finalize() not super.finalize()
JAVA0103 0.00JAVA0103 Explicit call to finalize()
JAVA0104 0.00JAVA0104 finalize() only calls super.finalize()
JAVA0105 0.00JAVA0105 Duplicate import declaration
JAVA0106 0.00JAVA0106 Unnecessary import from current package
JAVA0108 0.00JAVA0108 Incorrect javadoc: no @param tag for 'parameter'
JAVA0109 0.00JAVA0109 Incorrect javadoc: no parameter 'parameter'
JAVA0110 0.00JAVA0110 Incorrect javadoc: no @return tag
JAVA0111 0.00JAVA0111 Incorrect javadoc: @return tag for void method
JAVA0112 0.00JAVA0112 Incorrect javadoc: no exception 'exception' in throws
JAVA0113 1.00JAVA0113 Incorrect javadoc: no @author tag
JAVA0114 0.00JAVA0114 Incorrect javadoc: no @version tag
JAVA0115 0.00JAVA0115 Incorrect javadoc: no @throws or @exception tag for 'exception'
JAVA0116 0.00JAVA0116 Missing javadoc: field 'field'
JAVA0117 0.00JAVA0117 Missing javadoc: method 'method'
JAVA0118 0.00JAVA0118 Missing javadoc: type 'type'
JAVA0119 0.00JAVA0119 Control variable changed within body of for loop
JAVA0123 0.00JAVA0123 Use all three components of for loop
JAVA0125 0.00JAVA0125 Continue statement with label
JAVA0126 0.00JAVA0126 Method declares unchecked exception in throws
JAVA0128 0.00JAVA0128 Public constructor in non-public class
JAVA0130 0.00JAVA0130 Non-static method does not use instance fields
JAVA0131 0.00JAVA0131 Compatible method does not override base
JAVA0132 0.00JAVA0132 Method overload with compatible signature
JAVA0133 0.00JAVA0133 Non-synchronized method overrides synchronized method
JAVA0135 0.00JAVA0135 Only one of Object.equals and Object.hashCode defined: missing 'method'
JAVA0136 1.00JAVA0136 N methods defined in class (maximum: M)
JAVA0137 0.00JAVA0137 Non-abstract class missing constructor
JAVA0138 0.00JAVA0138 N parameters defined for method (maximum: M)
JAVA0139 0.00JAVA0139 Definition of main other than public static void main(java.lang.String[])
JAVA0141 0.00JAVA0141 Unnecessary modifier for method in interface
JAVA0143 0.00JAVA0143 Synchronized method
JAVA0144 0.00JAVA0144 Line exceeds maximum M characters
JAVA0145 0.00JAVA0145 Tab character used in source file
JAVA0150 0.00JAVA0150 java.lang.Error (or subclass) thrown
JAVA0153 0.00JAVA0153 Inefficient conversion of integer to string
JAVA0159 0.00JAVA0159 Inefficient conversion of string to integer
JAVA0160 0.00JAVA0160 Method does not throw specified exception
JAVA0161 0.00JAVA0161 Conditional wait() not in loop
JAVA0163 0.00JAVA0163 Empty statement
JAVA0165 0.00JAVA0165 Conflicting return statement in finally block
JAVA0166 0.00JAVA0166 Generic exception caught
JAVA0167 0.00JAVA0167 ThreadDeath not rethrown
JAVA0169 0.00JAVA0169 Unnecessary catch block: exception 'exception'
JAVA0170 0.00JAVA0170 Caught exception not derived from java.lang.Exception
JAVA0171 0.00JAVA0171 Unused local variable
JAVA0173 0.00JAVA0173 Unused method parameter
JAVA0174 0.00JAVA0174 Assigned local variable never used
JAVA0175 0.00JAVA0175 Successive assignment to variable
JAVA0176 0.00JAVA0176 Local variable name does not have required form
JAVA0177 1.00JAVA0177 Variable declaration missing initializer
JAVA0179 0.00JAVA0179 Local variable hides visible field
JAVA0233 0.00JAVA0233 Definition of serialVersionUID other than 'private static final long serialVersionUID'
JAVA0234 0.00JAVA0234 Class is Serializable but does not define serialVersionUID
JAVA0235 0.00JAVA0235 Class defines serialVersionUID but does not implement Serializable
JAVA0236 0.00JAVA0236 Attempt to clone an object which does not implement Cloneable
JAVA0237 0.00JAVA0237 Class implements Cloneable but does not have public clone method
JAVA0238 0.00JAVA0238 Clone method does not call super.clone()
JAVA0239 0.00JAVA0239 Class declares 'readObject' or 'writeObject' but does not implement Serializable
JAVA0240 0.00JAVA0240 Serializable class which declares readObject or writeObject but not both
JAVA0241 0.00JAVA0241 'readObject' or 'writeObject' should be declared private in Serializable class
JAVA0242 0.00JAVA0242 Transient field in non-Serializable class
JAVA0243 0.00JAVA0243 'readResolve' or 'writeReplace' should be declared private or protected
JAVA0244 0.00JAVA0244 Field or method name in subclass differs only by case from inherited field or method
JAVA0245 0.00JAVA0245 JUnit TestCase with non-trivial constructor
JAVA0246 0.00JAVA0246 JUnit assertXXX statement missing message parameter
JAVA0247 0.00JAVA0247 JUnit 'setUp()' and 'tearDown()' should call super method
JAVA0248 0.00JAVA0248 JUnit method 'setUp' or 'tearDown' with incorrect signature
JAVA0249 0.00JAVA0249 JUnit TestCase 'suite()' should be declared static
JAVA0250 0.00JAVA0250 JUnit TestCase declares testXXX method with incorrect signature
JAVA0251 0.00JAVA0251 Use '%n' for line breaks in printf/format for platform independence
JAVA0252 0.00JAVA0252 'enum' is a Java 1.5 reserved word
JAVA0253 0.00JAVA0253 Not all enum constants consumed in switch statement
JAVA0254 0.00JAVA0254 Use enhanced for loop construct instead of Iterator
JAVA0255 0.00JAVA0255 Result of method invocation not used
JAVA0256 0.00JAVA0256 Assignment of external collection/array to field
JAVA0257 0.00JAVA0257 Use of 'Constant Interface' anti-pattern
JAVA0258 0.00JAVA0258 Implement Iterable for foreach compatibility
JAVA0259 0.00JAVA0259 Return of collection/array field
JAVA0260 0.00JAVA0260 Use 'enum' instead of Enumerated Type pattern
JAVA0261 0.00JAVA0261 Use specialized Enum collection types
JAVA0262 0.00JAVA0262 Use of char in integer context
JAVA0263 0.00JAVA0263 Long literal ends with 'l' instead of 'L'
JAVA0264 0.00JAVA0264 Integer math in long context - check for overflow
JAVA0265 0.00JAVA0265 Use of Throwable.printStackTrace()
JAVA0266 0.00JAVA0266 Use of System.out
JAVA0267 0.00JAVA0267 Use of System.err
JAVA0269 0.00JAVA0269 Contents of StringBuffer never used
JAVA0270 0.00JAVA0270 Use Java 5.0 enhanced for loop construct to iterate over all elements in an array
JAVA0271 0.00JAVA0271 Minimize use of on-demand (.*) static imports
JAVA0272 0.00JAVA0272 Thread.run() called
JAVA0273 0.00JAVA0273 Non-final derivative of Thread calls start() in constructor
JAVA0274 0.00JAVA0274 Serializable class has a synchronized readObject()
JAVA0275 0.00JAVA0275 Serializable class has a synchronized writeObject() and no other synchronized methods
JAVA0276 0.00JAVA0276 Unnecessary use of String constructor
JAVA0277 0.00JAVA0277 Iterator.next() implementation does not throw NoSuchElementException
JAVA0278 0.00JAVA0278 Unnecessary use of Boolean constructor
JAVA0279 0.00JAVA0279 Serialization method readObject or readObjectNoData calls an overridable method
JAVA0280 0.00JAVA0280 IllegalMonitorStateException caught
JAVA0281 0.00JAVA0281 Iterator.next() not called in loop
JAVA0282 0.00JAVA0282 Call to Iterator.next() in loop which does not test Iterator.hasNext()
JAVA0283 0.00JAVA0283 Control variable not updated in loop body
JAVA0284 0.00JAVA0284 Explicit garbage collection
JAVA0285 0.00JAVA0285 Dereference of potentially null variable
JAVA0286 0.00JAVA0286 Dereference of null variable
JAVA0287 0.00JAVA0287 Unnecessary null check
JAVA0288 0.00JAVA0288 Inconsistent null check
LINES879.00Number of lines in the source file
LINE_COMMENT 2.00Number of line comments
LOC254.00Lines of code
LOGICAL_LINES97.00Number of statements
LOOPS 0.00Number of loops
NEST_DEPTH 4.00Maximum nesting depth
OPERANDS586.00Number of operands
OPERATORS1217.00Number of operators
PARAMS10.00Number of formal parameter declarations
PROGRAM_LENGTH1803.00Halstead program length
PROGRAM_VOCAB149.00Halstead program vocabulary
PROGRAM_VOLUME 0.00Halstead program volume
RETURNS61.00Number of return points from functions
SIZE31416.00Size of the file in bytes
UNIQUE_OPERANDS106.00Number of unique operands
UNIQUE_OPERATORS43.00Number of unique operators
WHITESPACE64.00Number of whitespace lines